CAS 67614-42-0 is the registry number for Apremilast Impurity 37. Offered by: Chemat Brand. Available pack sizes: on request.
4-acetamidophthalic acid (CAS 67614-42-0) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 4-acetamidophthalic acid. InChIKey: HFRRJDNGAZANLR-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 4-acetamidophthalic acid |
| InChIKey | HFRRJDNGAZANLR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)