CAS 67688-89-5 is the registry number for Ozagrel Impurity 23 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-[4-(aminomethyl)phenyl]prop-2-enoic acid;hydrochloride (CAS 67688-89-5) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (E)-3-[4-(aminomethyl)phenyl]prop-2-enoic acid;hydrochloride. InChIKey: VNUQVMNSUDBGRJ-IPZCTEOASA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (E)-3-[4-(aminomethyl)phenyl]prop-2-enoic acid;hydrochloride |
| InChIKey | VNUQVMNSUDBGRJ-IPZCTEOASA-N |
| SMILES | C1=CC(=CC=C1CN)/C=C/C(=O)O.Cl |
Computed by PubChem (NCBI)