Products 67754-03-4
CAS 67754-03-4 appears in our catalog under these names: Methyl 2,5–Dichloronicotinate, Methyl 2,5-Dichloronicotinate, >98.0%(GC), Methyl 2,5-dichloronicotinate 98%, Methyl 2,5-dichloronicotinate, 98%, 98%, Methyl2,5-dichloronicotinate, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 200mg, 1g, 100mg, 250mg, 10g, 100g.
Methyl 2,5-dichloropyridine-3-carboxylate (CAS 67754-03-4) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: methyl 2,5-dichloropyridine-3-carboxylate. InChIKey: CNPFXYWTMBTSSI-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | methyl 2,5-dichloropyridine-3-carboxylate |
| InChIKey | CNPFXYWTMBTSSI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)