CAS 677762-57-1 appears in our catalog under these names: 1-Cyclopropyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid, 95+%, 1-Cyclopropyl-6-oxo-1,6-dihydropyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
1-cyclopropyl-6-oxopyridine-3-carboxylic acid (CAS 677762-57-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-cyclopropyl-6-oxopyridine-3-carboxylic acid. InChIKey: WTEIFYMIOHDHRC-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-cyclopropyl-6-oxopyridine-3-carboxylic acid |
| InChIKey | WTEIFYMIOHDHRC-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=C(C=CC2=O)C(=O)O |
Computed by PubChem (NCBI)