CAS 6797-44-0 appears in our catalog under these names: 1-Phenyl-1,2,3-butanetrione 2-oxime, 95%, 1-Phenyl-1,2,3-butanetrione 2-oxime, 98+% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
(E)-4-hydroxy-3-nitroso-4-phenylbut-3-en-2-one (CAS 6797-44-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: (E)-4-hydroxy-3-nitroso-4-phenylbut-3-en-2-one. InChIKey: UMQCXGGBHYGWTG-MDZDMXLPSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | (E)-4-hydroxy-3-nitroso-4-phenylbut-3-en-2-one |
| InChIKey | UMQCXGGBHYGWTG-MDZDMXLPSA-N |
| SMILES | CC(=O)/C(=C(/C1=CC=CC=C1)\O)/N=O |
Computed by PubChem (NCBI)