CAS 68047-36-9 appears in our catalog under these names: 6-Amino-7-hydroxy-4-methyl-2h-chromen-2-one, 95%, 6-Amino-7-hydroxy-4-methylcoumarin. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 25mg, 10mg, 50mg.
6-amino-7-hydroxy-4-methylchromen-2-one (CAS 68047-36-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 6-amino-7-hydroxy-4-methylchromen-2-one. InChIKey: WDLJTLKIEHIDHO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 6-amino-7-hydroxy-4-methylchromen-2-one |
| InChIKey | WDLJTLKIEHIDHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=CC(=C(C=C12)N)O |
Computed by PubChem (NCBI)