CAS 682802-87-5 is the registry number for 1H-Indole-3,5-dicarbaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
1H-indole-3,5-dicarbaldehyde (CAS 682802-87-5) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 1H-indole-3,5-dicarbaldehyde. InChIKey: ZUZXRKSFCBCQIA-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 1H-indole-3,5-dicarbaldehyde |
| InChIKey | ZUZXRKSFCBCQIA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=O)C(=CN2)C=O |
Computed by PubChem (NCBI)