Products 683235-34-9
CAS 683235-34-9 is the registry number for VEGFR-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-acetyl-N-(1,3-dioxoisoindol-5-yl)benzamide (CAS 683235-34-9) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 4-acetyl-N-(1,3-dioxoisoindol-5-yl)benzamide. InChIKey: GYOFRVJBBKXYJR-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 4-acetyl-N-(1,3-dioxoisoindol-5-yl)benzamide |
| InChIKey | GYOFRVJBBKXYJR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)C(=O)NC3=O |
Computed by PubChem (NCBI)