CAS 685904-18-1 appears in our catalog under these names: 5-(Phenoxymethyl)furan-2-carbaldehyde, 5-Phenoxymethyl-furan-2-carbaldehyde. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g.
5-(phenoxymethyl)furan-2-carbaldehyde (CAS 685904-18-1) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 5-(phenoxymethyl)furan-2-carbaldehyde. InChIKey: UEFQGYJMYZTWIJ-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-(phenoxymethyl)furan-2-carbaldehyde |
| InChIKey | UEFQGYJMYZTWIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CC=C(O2)C=O |
Computed by PubChem (NCBI)