CAS 68701-14-4 appears in our catalog under these names: 2-Amino-5-ethoxybenzoic acid, 97%, 2-Amino-5-ethoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-amino-5-ethoxybenzoic acid (CAS 68701-14-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-5-ethoxybenzoic acid. InChIKey: NKTUASQGQPRDBW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-5-ethoxybenzoic acid |
| InChIKey | NKTUASQGQPRDBW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)