CAS 68790-38-5 appears in our catalog under these names: Boc–Abz–OH, Boc-2-Abz-OH, Boc-2-aminobenzoic acid, BOC-2-ABZ-OH, >=98.0% T, 2-Boc-aminobenzoic acid, 95%, 95%. Offered by: GLPBio, Iris Biotech, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 2g, 15g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 68790-38-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: BYGHHEDJDSLEKK-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | BYGHHEDJDSLEKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)