CAS 69026-14-8 appears in our catalog under these names: 3-(Benzyloxy)benzoic acid, 96%, 3-Benzyloxybenzoic acid, 98% , 3-Benzyloxybenzoic acid 96%, 3-BENZYLOXYBENZOIC ACID, 97%, 3-(benzyloxy)benzoic acid, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 25g, 1g, 100g, 5g, 2.5g.
3-phenylmethoxybenzoic acid (CAS 69026-14-8) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 3-phenylmethoxybenzoic acid. InChIKey: CISXCTKEQYOZAM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 3-phenylmethoxybenzoic acid |
| InChIKey | CISXCTKEQYOZAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)