CAS 690260-94-7 appears in our catalog under these names: Ethyl 3-bromo-5-nitrobenzoate 98%, Ethyl 3-Bromo-5-nitrobenzoate, 98%, 98%, Ethyl 3-bromo-5-nitrobenzoate, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100g.
Ethyl 3-bromo-5-nitrobenzoate (CAS 690260-94-7) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 3-bromo-5-nitrobenzoate. InChIKey: PUBVWGDKFHIPRR-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | ethyl 3-bromo-5-nitrobenzoate |
| InChIKey | PUBVWGDKFHIPRR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)