Products 69291-65-2
CAS 69291-65-2 is the registry number for 1-(Difluoromethyl)-2,5-difluoro-4-nitrobenzene, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(difluoromethyl)-2,5-difluoro-4-nitrobenzene (CAS 69291-65-2) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 1-(difluoromethyl)-2,5-difluoro-4-nitrobenzene. InChIKey: TWFWINIUVNXRHG-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 1-(difluoromethyl)-2,5-difluoro-4-nitrobenzene |
| InChIKey | TWFWINIUVNXRHG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])F)C(F)F |
Computed by PubChem (NCBI)