Products 693286-31-6
CAS 693286-31-6 appears in our catalog under these names: 4，6–Dichloro–2–methylnicotinic Acid, 4,6-Dichloro-2-methylnicotinic acid, 4,6-Dichloro-2-methylnicotinic acid 97%, 3-Pyridinecarboxylic acid, 4,6-dichloro-2-methyl-, 97%, 97%, 4,6-Dichloro-2-methylnicotinic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2g, 100mg, 250mg, 500mg.
4,6-dichloro-2-methylpyridine-3-carboxylic acid (CAS 693286-31-6) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 4,6-dichloro-2-methylpyridine-3-carboxylic acid. InChIKey: GWYIZOFIYNAMAC-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 4,6-dichloro-2-methylpyridine-3-carboxylic acid |
| InChIKey | GWYIZOFIYNAMAC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=N1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)