Products 69579-74-4
CAS 69579-74-4 is the registry number for Adustin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3-hydroxyfuran-2-yl)-phenylmethanone (CAS 69579-74-4) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: (3-hydroxyfuran-2-yl)-phenylmethanone. InChIKey: RAFAVNTVTXJMAQ-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (3-hydroxyfuran-2-yl)-phenylmethanone |
| InChIKey | RAFAVNTVTXJMAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CO2)O |
Computed by PubChem (NCBI)