Products 696588-49-5
CAS 696588-49-5 is the registry number for Methyl 4-(amino(phenyl)methyl)benzoate hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 4-[amino(phenyl)methyl]benzoate;hydrochloride (CAS 696588-49-5) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: methyl 4-[amino(phenyl)methyl]benzoate;hydrochloride. InChIKey: LUCQZGRVABQSBJ-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | methyl 4-[amino(phenyl)methyl]benzoate;hydrochloride |
| InChIKey | LUCQZGRVABQSBJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)