CAS 70154-01-7 is the registry number for 2-(5-Methylbenzo[d]isoxazol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
2-(5-methyl-1,2-benzoxazol-3-yl)acetic acid (CAS 70154-01-7) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-(5-methyl-1,2-benzoxazol-3-yl)acetic acid. InChIKey: DWBGJXYUEQQNNC-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(5-methyl-1,2-benzoxazol-3-yl)acetic acid |
| InChIKey | DWBGJXYUEQQNNC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)ON=C2CC(=O)O |
Computed by PubChem (NCBI)