Products 702641-01-8

CAS 702641-01-8 is the registry number for 2-(5-bromo-2-iodophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,1g, 0,25g, 0,5g, 1g, 2g.

Structural formula: {0} (CAS {1})

2-(5-bromo-2-iodophenyl)acetic acid (CAS 702641-01-8) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 2-(5-bromo-2-iodophenyl)acetic acid. InChIKey: HRLIMSANESJAIA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrIO2
Molecular weight340.94 g/mol
IUPAC name2-(5-bromo-2-iodophenyl)acetic acid
InChIKeyHRLIMSANESJAIA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)CC(=O)O)I

Computed by PubChem (NCBI)