Products 70278-64-7
CAS 70278-64-7 appears in our catalog under these names: 3,4-dibenzyloxycyclobut-3-ene-1,2-dione, 97%, 97%, 3,4-dibenzyloxycyclobut-3-ene-1,2-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3,4-bis(phenylmethoxy)cyclobut-3-ene-1,2-dione (CAS 70278-64-7) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 3,4-bis(phenylmethoxy)cyclobut-3-ene-1,2-dione. InChIKey: CJEMPPHWLBOPGS-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 3,4-bis(phenylmethoxy)cyclobut-3-ene-1,2-dione |
| InChIKey | CJEMPPHWLBOPGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=O)C2=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)