CAS 70358-38-2 appears in our catalog under these names: 2-N-(4-Methylphenyl)pyridine-2,3-diamine, N2-(4-Methylphenyl)-2,3-pyridinediamine, 95+%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
2-N-(4-methylphenyl)pyridine-2,3-diamine (CAS 70358-38-2) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 2-N-(4-methylphenyl)pyridine-2,3-diamine. InChIKey: NRRYCBFHCDAHCV-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-N-(4-methylphenyl)pyridine-2,3-diamine |
| InChIKey | NRRYCBFHCDAHCV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=CC=N2)N |
Computed by PubChem (NCBI)