CAS 70362-46-8 is the registry number for PCB 43, ROTI®Star, 10 mg, glass. Offered by: Roth. Available pack sizes: 10mg.
1,2,5-trichloro-3-(2-chlorophenyl)benzene (CAS 70362-46-8) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 292.0 g/mol. IUPAC name: 1,2,5-trichloro-3-(2-chlorophenyl)benzene. InChIKey: NRBNBYFPJCCKTO-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 292.0 g/mol |
| IUPAC name | 1,2,5-trichloro-3-(2-chlorophenyl)benzene |
| InChIKey | NRBNBYFPJCCKTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C(=CC(=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)