Products 70413-94-4
CAS 70413-94-4 is the registry number for 5-Fluoro-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-2-methyl-3,1-benzoxazin-4-one (CAS 70413-94-4) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 5-fluoro-2-methyl-3,1-benzoxazin-4-one. InChIKey: NAUIWYYNNRTHOS-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-fluoro-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | NAUIWYYNNRTHOS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC=C2)F)C(=O)O1 |
Computed by PubChem (NCBI)