CAS 70599-87-0 is the registry number for 1-Nitro-3-(propyloxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-nitro-3-propoxybenzene (CAS 70599-87-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-nitro-3-propoxybenzene. InChIKey: ATCLUTSGXRLRKU-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-nitro-3-propoxybenzene |
| InChIKey | ATCLUTSGXRLRKU-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)