Products 7098-80-8
CAS 7098-80-8 appears in our catalog under these names: Gmak, 95%, Solketal methacrylate, (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl methacrylate 98% stabilized TBC, (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-methyl-2-propenoate, 98% stabilized TBC, 98% stabilized TBC. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 25ml, 5ml, 100g.
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate (CAS 7098-80-8) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate. InChIKey: JPFPDGRVRGETED-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate |
| InChIKey | JPFPDGRVRGETED-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC1COC(O1)(C)C |
Computed by PubChem (NCBI)
Synonyms:
(2,2-Dimethyl-1,3-dioxolan-4-yl)methyl methacrylate, Solketal methacrylate, isopropylideneglyceryl methacrylate, BISOMER IPGMA, 2-Propenoic acid, 2-methyl-, (2,2-dimethyl-1,3-dioxolan-4-yl)methyl ester, ISOPROPYLIDENEGLYCERYL METHACRYLATE [INCI], (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2-methylprop-2-enoate, (2,2-Dimethyl-1,3-dioxolan-4-yl)methyl 2-methyl-2-propenoate, GMAK, 2,2-Dimethyl-1,3-dioxolane-4-methanol methacrylate