CAS 70987-78-9 appears in our catalog under these names: (R)-Glycidyl Tosylate, (2S)-(+)-Glycidyl Tosylate, (S)-Glycidyl tosylate, (2S)–(+)–Glycidyl tosylate, S-(+)-Glycidyl tosylate. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: on request, 10g, 25g, 5g, 100mg, 100g, 1g, 500g.
[(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate (CAS 70987-78-9) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: [(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: NOQXXYIGRPAZJC-VIFPVBQESA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | [(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | NOQXXYIGRPAZJC-VIFPVBQESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2CO2 |
Computed by PubChem (NCBI)