Products 70987-96-1
CAS 70987-96-1 appears in our catalog under these names: 7，3'，4'–Tri–O–methyleriodictyol, 7,3′,4′-Tri-O-methyleriodictyol/ 97.06% (existing batch purity), 7,3',4'-Tri-o-methyleriodictyol, 7,3′,4′-Tri-O-methyleriodictyol. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 2mg, 25 mg, 10 mg.
2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one (CAS 70987-96-1) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one. InChIKey: MRFOCZPULZWYTJ-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | MRFOCZPULZWYTJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CC(=O)C3=C(C=C(C=C3O2)OC)O)OC |
Computed by PubChem (NCBI)