Products 7099-87-8
CAS 7099-87-8 appears in our catalog under these names: 2–(4–Bromophenyl)–2–oxoacetic acid, 2-(4-bromophenyl)-2-oxoacetic acid, 2-(4-Bromophenyl)-2-oxoacetic acid 95%, 2-(4-Bromophenyl)-2-oxoacetic acid, 95%, 95%, 2-(4-Bromophenyl)-2-oxoacetic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
2-(4-bromophenyl)-2-oxoacetic acid (CAS 7099-87-8) is a chemical compound with the molecular formula C8H5BrO3 and a molecular weight of 229.03 g/mol. IUPAC name: 2-(4-bromophenyl)-2-oxoacetic acid. InChIKey: UASZGGQRDGLTIQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrO3 |
|---|---|
| Molecular weight | 229.03 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-oxoacetic acid |
| InChIKey | UASZGGQRDGLTIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(=O)O)Br |
Computed by PubChem (NCBI)