CAS 71064-07-8 is the registry number for 4,6-Dimethoxybenzo[d]isoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dimethoxy-1,2-benzoxazole (CAS 71064-07-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4,6-dimethoxy-1,2-benzoxazole. InChIKey: WDVYLYYDNBRGFU-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 4,6-dimethoxy-1,2-benzoxazole |
| InChIKey | WDVYLYYDNBRGFU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=NO2)C(=C1)OC |
Computed by PubChem (NCBI)