Products 710990-99-1

CAS 710990-99-1 is the registry number for 2-(5-Methoxy-4,7-dimethyl-2-oxo-2H-chromen-3-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)acetic acid (CAS 710990-99-1) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)acetic acid. InChIKey: OOPOQJUVKPZTSI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14O5
Molecular weight262.26 g/mol
IUPAC name2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)acetic acid
InChIKeyOOPOQJUVKPZTSI-UHFFFAOYSA-N
SMILESCC1=CC2=C(C(=C(C(=O)O2)CC(=O)O)C)C(=C1)OC

Computed by PubChem (NCBI)