CAS 710990-99-1 is the registry number for 2-(5-Methoxy-4,7-dimethyl-2-oxo-2H-chromen-3-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)acetic acid (CAS 710990-99-1) is a chemical compound with the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. IUPAC name: 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)acetic acid. InChIKey: OOPOQJUVKPZTSI-UHFFFAOYSA-N.
| Molecular formula | C14H14O5 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 2-(5-methoxy-4,7-dimethyl-2-oxochromen-3-yl)acetic acid |
| InChIKey | OOPOQJUVKPZTSI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C(=O)O2)CC(=O)O)C)C(=C1)OC |
Computed by PubChem (NCBI)