CAS 713083-74-0 is the registry number for 4-Chloro-3-([(2,5-dimethylphenyl)amino]sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzoic acid (CAS 713083-74-0) is a chemical compound with the molecular formula C15H14ClNO4S and a molecular weight of 339.8 g/mol. IUPAC name: 4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzoic acid. InChIKey: ZZEKYGKBIRSMBN-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO4S |
|---|---|
| Molecular weight | 339.8 g/mol |
| IUPAC name | 4-chloro-3-[(2,5-dimethylphenyl)sulfamoyl]benzoic acid |
| InChIKey | ZZEKYGKBIRSMBN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NS(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)