CAS 714237-95-3 appears in our catalog under these names: Methyl 5-bromo-2-cyanobenzoate, 95%, 95%, Methyl 5-bromo-2-cyanobenzoate 95%, Methyl 5-bromo-2-cyanobenzoate, 95%, Methyl 5–bromo–2–cyanobenzoate. Offered by: Chemat, Ambeed, Fluorochem, GLPBio. Available pack sizes: 10g, 25g, 100mg, 250mg, 1g, 5g.
Methyl 5-bromo-2-cyanobenzoate (CAS 714237-95-3) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: methyl 5-bromo-2-cyanobenzoate. InChIKey: JYCDKDCBYOOZLW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | methyl 5-bromo-2-cyanobenzoate |
| InChIKey | JYCDKDCBYOOZLW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Br)C#N |
Computed by PubChem (NCBI)