Products 7153-28-8
CAS 7153-28-8 is the registry number for 5-(3,4-Dichlorophenyl)imidazolidine-2,4-dione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(3,4-dichlorophenyl)imidazolidine-2,4-dione (CAS 7153-28-8) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)imidazolidine-2,4-dione. InChIKey: UZHGPHDIPRADRK-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)imidazolidine-2,4-dione |
| InChIKey | UZHGPHDIPRADRK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2C(=O)NC(=O)N2)Cl)Cl |
Computed by PubChem (NCBI)