CAS 7187-31-7 appears in our catalog under these names: [1-(4-Chlorobenzyl)-1h-benzimidazol-2-yl]methanol, 95%, {1-((4-Chlorophenyl)methyl)-1H-1,3-benzodiazol-2-yl}methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
[1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]methanol (CAS 7187-31-7) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: [1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]methanol. InChIKey: VUZVSFJBGRTRQC-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | [1-[(4-chlorophenyl)methyl]benzimidazol-2-yl]methanol |
| InChIKey | VUZVSFJBGRTRQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2CC3=CC=C(C=C3)Cl)CO |
Computed by PubChem (NCBI)