CAS 183484-74-4 is the registry number for Ethacridine Impurity 2. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
9-chloro-7-ethoxyacridin-3-amine (CAS 183484-74-4) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 9-chloro-7-ethoxyacridin-3-amine. InChIKey: BVCINJSAPJDDQB-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 9-chloro-7-ethoxyacridin-3-amine |
| InChIKey | BVCINJSAPJDDQB-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)N)N=C2C=C1)Cl |
Computed by PubChem (NCBI)