CAS 1019456-03-1 appears in our catalog under these names: 1-((4-Aminophenyl)methyl)-6-chloro-2,3-dihydro-1H-indol-2-one, 95%, 1-((4-Aminophenyl)methyl)-6-chloro-2,3-dihydro-1H-indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-[(4-aminophenyl)methyl]-6-chloro-3H-indol-2-one (CAS 1019456-03-1) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 1-[(4-aminophenyl)methyl]-6-chloro-3H-indol-2-one. InChIKey: XKOCNKBFZSKJIC-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 1-[(4-aminophenyl)methyl]-6-chloro-3H-indol-2-one |
| InChIKey | XKOCNKBFZSKJIC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Cl)N(C1=O)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)