CAS 1094434-45-3 is the registry number for 4-(3-(2-Chloroacetyl)-2,5-dimethyl-1H-pyrrol-1-yl)benzonitrile, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzonitrile (CAS 1094434-45-3) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzonitrile. InChIKey: FSUYVICJOLYXMP-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 4-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzonitrile |
| InChIKey | FSUYVICJOLYXMP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)C#N)C)C(=O)CCl |
Computed by PubChem (NCBI)