CAS 2173253-09-1 is the registry number for 4-(3-Chlorophenyl)-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (CAS 2173253-09-1) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one. InChIKey: GHLQGCRCRKOHRO-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| InChIKey | GHLQGCRCRKOHRO-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2NC1=O)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)