CAS 855939-48-9 appears in our catalog under these names: 6-Chloro-2-ethoxyacridin-9-amine, 95+%, Ethacridine Impurity 2. Offered by: AmBeed, Chemat Brand. Available pack sizes: 1g, on request.
6-chloro-2-ethoxyacridin-9-amine (CAS 855939-48-9) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: 6-chloro-2-ethoxyacridin-9-amine. InChIKey: QFNHSWUFPJOTIR-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 6-chloro-2-ethoxyacridin-9-amine |
| InChIKey | QFNHSWUFPJOTIR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)Cl)N=C2C=C1)N |
Computed by PubChem (NCBI)