Products 81591-43-7
CAS 81591-43-7 is the registry number for N-(4-Methylphenyl)-2-oxo-2-phenylethanehydrazonoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(1Z)-N-(4-methylphenyl)-2-oxo-2-phenylethanehydrazonoyl chloride (CAS 81591-43-7) is a chemical compound with the molecular formula C15H13ClN2O and a molecular weight of 272.73 g/mol. IUPAC name: (1Z)-N-(4-methylphenyl)-2-oxo-2-phenylethanehydrazonoyl chloride. InChIKey: UNHCZZQUWWMHBV-SDXDJHTJSA-N.
| Molecular formula | C15H13ClN2O |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | (1Z)-N-(4-methylphenyl)-2-oxo-2-phenylethanehydrazonoyl chloride |
| InChIKey | UNHCZZQUWWMHBV-SDXDJHTJSA-N |
| SMILES | CC1=CC=C(C=C1)N/N=C(/C(=O)C2=CC=CC=C2)\Cl |
Computed by PubChem (NCBI)