Products 71987-42-3
CAS 71987-42-3 appears in our catalog under these names: 4,4'-(E)-Diazene-1,2-diyldibenzoic acid 98% HPLC, 4,4'-(E)-Diazene-1,2-diyldibenzoic acid, 98% HPLC, 98% HPLC. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
4-[(4-carboxyphenyl)diazenyl]benzoic acid (CAS 71987-42-3) is a chemical compound with the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. IUPAC name: 4-[(4-carboxyphenyl)diazenyl]benzoic acid. InChIKey: NWHZQELJCLSKNV-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O4 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 4-[(4-carboxyphenyl)diazenyl]benzoic acid |
| InChIKey | NWHZQELJCLSKNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4,4'-Azobisbenzoic acid, Azobenzene-4,4'-dicarboxylic Acid, 4,4'-(E)-diazene-1,2-diyldibenzoic acid, 4,4'-(Diazene-1,2-diyl)dibenzoic acid, 4-[(4-carboxyphenyl)diazenyl]benzoic acid, (E)-4,4'-(Diazene-1,2-diyl)dibenzoic acid, 4,4'-Azodibenzoic Acid, Benzoic acid, 4,4'-azobis-, (E)-Azobenzene-4,4'-dicarboxylic acid, 4,4'-azobenzenedicarboxylic acid