CAS 720-98-9 appears in our catalog under these names: 4-Amino-phenol 1-benzoate, 95%, 4-Amino-phenol 1-benzoate, 95%, 95%, 4-Amino-phenol 1-benzoate, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(4-aminophenyl) benzoate (CAS 720-98-9) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: (4-aminophenyl) benzoate. InChIKey: OFZBREYRUUQJQG-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | (4-aminophenyl) benzoate |
| InChIKey | OFZBREYRUUQJQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)