CAS 721-22-2 appears in our catalog under these names: 2–(3–(Trifluoromethyl)phenyl)cyclopropane–1–carboxylic acid, 2-[3-(Trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 721-22-2) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: IBXCFDILOTYDLI-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | IBXCFDILOTYDLI-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)