CAS 2262-03-5 appears in our catalog under these names: 2-(4-(Trifluoromethyl)phenyl)cyclopropanecarboxylic acid, 95%, 2-(4-(Trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, 95%, 2–(4–(Trifluoromethyl)phenyl)cyclopropane–1–carboxylic acid, 2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 2262-03-5) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: UKRIUIRBTVRYAH-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | UKRIUIRBTVRYAH-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)