CAS 258346-69-9 appears in our catalog under these names: 1-(4-Trifluoromethylphenyl)butane-1,3-dione, 95%, 1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione 98%, 1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione, 98%, 98%, 1-(4-(Trifluoromethyl)phenyl)butane-1,3-dione, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
1-[4-(trifluoromethyl)phenyl]butane-1,3-dione (CAS 258346-69-9) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione. InChIKey: DLIOGFQTFUVFFB-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]butane-1,3-dione |
| InChIKey | DLIOGFQTFUVFFB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)