CAS 53764-99-1 appears in our catalog under these names: 4,4,4-Trifluoro-1-(3-methylphenyl)-1,3-butanedione, 4,4,4-Trifluoro-1-(m-tolyl)butane-1,3-dione, 95%, 4,4,4–Trifluoro–1–(m–tolyl)butane–1,3–dione, Moxifloxacin Impurity 14 97%, 4,4,4-Trifluoro-1-(m-tolyl)butane-1,3-dione, 97%, 97%. Offered by: TRC, Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 5g, 1g.
4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione (CAS 53764-99-1) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione. InChIKey: VOFWLZQTWRLBTR-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O2 |
|---|---|
| Molecular weight | 230.18 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione |
| InChIKey | VOFWLZQTWRLBTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)