Products 886366-06-9

CAS 886366-06-9 is the registry number for 1-(2-(Trifluoromethyl)phenyl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

1-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 886366-06-9) is a chemical compound with the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. IUPAC name: 1-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: CQKNWCFXZVEBEO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9F3O2
Molecular weight230.18 g/mol
IUPAC name1-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid
InChIKeyCQKNWCFXZVEBEO-UHFFFAOYSA-N
SMILESC1CC1(C2=CC=CC=C2C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)