CAS 72133-34-7 appears in our catalog under these names: 5-(3-Chlorophenoxy)picolinic acid, 97%, 5-(3-Chlorophenoxy)pyridine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(3-chlorophenoxy)pyridine-2-carboxylic acid (CAS 72133-34-7) is a chemical compound with the molecular formula C12H8ClNO3 and a molecular weight of 249.65 g/mol. IUPAC name: 5-(3-chlorophenoxy)pyridine-2-carboxylic acid. InChIKey: RBYCZLPCBDKRPG-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO3 |
|---|---|
| Molecular weight | 249.65 g/mol |
| IUPAC name | 5-(3-chlorophenoxy)pyridine-2-carboxylic acid |
| InChIKey | RBYCZLPCBDKRPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)OC2=CN=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)