Products 72256-96-3
CAS 72256-96-3 appears in our catalog under these names: 5-Bromo-2,4-dimethylbenzenesulfonyl chloride, 5-Bromo-2,4-dimethylbenzenesulfonyl chloride, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5g, 0,5g, 1g.
5-bromo-2,4-dimethylbenzenesulfonyl chloride (CAS 72256-96-3) is a chemical compound with the molecular formula C8H8BrClO2S and a molecular weight of 283.57 g/mol. IUPAC name: 5-bromo-2,4-dimethylbenzenesulfonyl chloride. InChIKey: PVNIDZKWTRPCOG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO2S |
|---|---|
| Molecular weight | 283.57 g/mol |
| IUPAC name | 5-bromo-2,4-dimethylbenzenesulfonyl chloride |
| InChIKey | PVNIDZKWTRPCOG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)Br)C |
Computed by PubChem (NCBI)