Products 724-98-1
CAS 724-98-1 appears in our catalog under these names: 2-(Phenoxymethyl)benzoic acid, 98%, 98%, 2-Phenoxymethylbenzoic acid, 98%, 2-(Phenoxymethyl)benzoic acid, 95%, 2–Phenoxymethylbenzoic Acid, 2-Phenoxymethylbenzoic Acid, >98.0%(GC)(T). Offered by: Chemat, Fluorochem, Combi-blocks, GLPBio, TCI. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
2-(phenoxymethyl)benzoic acid (CAS 724-98-1) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2-(phenoxymethyl)benzoic acid. InChIKey: YKNORODREYVARM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2-(phenoxymethyl)benzoic acid |
| InChIKey | YKNORODREYVARM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)